| MolName | 7,8-dimethoxy-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C22H20N4O4 |
| Smiles | C/C(/C=N\N(C(c([nH]c(cc1OC)c2cc1OC)c2N1)=O)C1=O)=C/c1ccccc1 |
| InChI | InChI=1S/C22H20N4O4/c1-13(9-14-7-5-4-6-8-14)12-23-26-21(27)20-19(25-22(26)28)15-10-17(29-2)18(30-3)11-16(15)24-20/h4-12,24H,1-3H3,(H,25,28) |
| InChIK | YANOKNHNNGRAEU-UHFFFAOYSA-N |
| TotalMolweight | 404.425 |
| Molweight | 404.425 |
| MonoisotopicMass | 404.148456 |
| CLogP | 3.0011 |
| CLogS | -5.099 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 307.2 |
| Relative PSA | 0.28187 |
| PolarSurfaceArea | 96.02 |
| Druglikeness | 5.1722 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 7,8-dimethoxy-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 7,8-dimethoxy-3-[(Z)-[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione