| MolName | N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C21H19N5OS2 |
| Smiles | C(COCC1)N1c1nc(-c2ccccc2)c(/C=N\Nc2nc(cccc3)c3s2)s1 |
| InChI | InChI=1S/C21H19N5OS2/c1-2-6-15(7-3-1)19-18(29-21(24-19)26-10-12-27-13-11-26)14-22-25-20-23-16-8-4-5-9-17(16)28-20/h1-9,14H,10-13H2,(H,23,25) |
| InChIK | YAOUOCPFEDODPZ-UHFFFAOYSA-N |
| TotalMolweight | 421.548 |
| Molweight | 421.548 |
| MonoisotopicMass | 421.1031 |
| CLogP | 6.77 |
| CLogS | -5.84 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 314.84 |
| Relative PSA | 0.31502 |
| PolarSurfaceArea | 119.12 |
| Druglikeness | 4.6241 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine