| MolName | N-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylideneamino]furan-2-carboxamide |
| MolecularFormula | C22H22N4O5 |
| Smiles | [O-][N+](c1cc(/C=C(\CC2)/C(N3CCOCC3)=C2/C=N\NC(c2ccco2)=O)ccc1)=O |
| InChI | InChI=1S/C22H22N4O5/c27-22(20-5-2-10-31-20)24-23-15-18-7-6-17(21(18)25-8-11-30-12-9-25)13-16-3-1-4-19(14-16)26(28)29/h1-5,10,13-15H,6-9,11-12H2,(H,24,27) |
| InChIK | YAVPWWXBTHPCBV-UHFFFAOYSA-N |
| TotalMolweight | 422.44 |
| Molweight | 422.44 |
| MonoisotopicMass | 422.159021 |
| CLogP | 2.0482 |
| CLogS | -4.429 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 323.84 |
| Relative PSA | 0.29054 |
| PolarSurfaceArea | 112.89 |
| Druglikeness | -0.44181 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylideneamino]furan-2-carboxamide | 2 - N-[(Z)-[(3E)-2-morpholin-4-yl-3-[(3-nitrophenyl)methylidene]cyclopenten-1-yl]methylideneamino]furan-2-carboxamide