| MolName | (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-piperidin-1-ylmethanimine |
| MolecularFormula | C26H28N2O2 |
| Smiles | C(c1ccccc1)Oc(ccc(/C=N\N1CCCCC1)c1)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O2/c1-4-10-22(11-5-1)20-29-25-15-14-24(19-27-28-16-8-3-9-17-28)18-26(25)30-21-23-12-6-2-7-13-23/h1-2,4-7,10-15,18-19H,3,8-9,16-17,20-21H2 |
| InChIK | YAVXMFYUUOHLNL-UHFFFAOYSA-N |
| TotalMolweight | 400.52 |
| Molweight | 400.52 |
| MonoisotopicMass | 400.215078 |
| CLogP | 5.3517 |
| CLogS | -5.402 |
| H Acceptors | 4 |
| TotalSurfaceArea | 330.66 |
| Relative PSA | 0.10603 |
| PolarSurfaceArea | 34.06 |
| Druglikeness | 1.5487 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-piperidin-1-ylmethanimine | 2 - (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-piperidin-1-ylmethanimine