| MolName | 4,6-bis(azepan-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C20H29N7O |
| Smiles | C(CCC1)CCN1c1nc(N/N=C\c2ccco2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C20H29N7O/c1-2-6-12-26(11-5-1)19-22-18(25-21-16-17-10-9-15-28-17)23-20(24-19)27-13-7-3-4-8-14-27/h9-10,15-16H,1-8,11-14H2,(H,22,23,24,25) |
| InChIK | YBIDJSGYHAQLIB-UHFFFAOYSA-N |
| TotalMolweight | 383.498 |
| Molweight | 383.498 |
| MonoisotopicMass | 383.243358 |
| CLogP | 5.8012 |
| CLogS | -5.541 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 313.93 |
| Relative PSA | 0.24556 |
| PolarSurfaceArea | 82.68 |
| Druglikeness | -0.28352 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 12 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-bis(azepan-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-bis(azepan-1-yl)-N-[(Z)-furan-2-ylmethylideneamino]-1,3,5-triazin-2-amine