| MolName | 2-chloro-N-[(Z)-[4-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenyl]methylideneamino]-5-(trifluoromethyl)aniline |
| MolecularFormula | C22H14N4Cl2F6 |
| Smiles | FC(c(cc1)cc(N/N=C\c2ccc(/C=N\Nc(cc(C(F)(F)F)cc3)c3Cl)cc2)c1Cl)(F)F |
| InChI | InChI=1S/C22H14Cl2F6N4/c23-17-7-5-15(21(25,26)27)9-19(17)33-31-11-13-1-2-14(4-3-13)12-32-34-20-10-16(22(28,29)30)6-8-18(20)24/h1-12,33-34H |
| InChIK | YBSIDGNHTFZRKN-UHFFFAOYSA-N |
| TotalMolweight | 519.275 |
| Molweight | 519.275 |
| MonoisotopicMass | 518.049968 |
| CLogP | 10.931 |
| CLogS | -7.71 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 354.98 |
| Relative PSA | 0.12942 |
| PolarSurfaceArea | 48.78 |
| Druglikeness | -4.8055 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 20 |
| StereoCon |
Click to Load Molecule:
1 - 2-chloro-N-[(Z)-[4-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenyl]methylideneamino]-5-(trifluoromethyl)aniline | 2 - 2-chloro-N-[(Z)-[4-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenyl]methylideneamino]-5-(trifluoromethyl)aniline