| MolName | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| MolecularFormula | C26H24N4O6 |
| Smiles | O=C(COc1c(/C=N\NC(C(NCc(cc2)cc3c2OCO3)=O)=O)cccc1)NCc1ccccc1 |
| InChI | InChI=1S/C26H24N4O6/c31-24(27-13-18-6-2-1-3-7-18)16-34-21-9-5-4-8-20(21)15-29-30-26(33)25(32)28-14-19-10-11-22-23(12-19)36-17-35-22/h1-12,15H,13-14,16-17H2,(H,27,31)(H,28,32)(H,30,33) |
| InChIK | YCLSPHQCNXORKZ-UHFFFAOYSA-N |
| TotalMolweight | 488.499 |
| Molweight | 488.499 |
| MonoisotopicMass | 488.169586 |
| CLogP | 2.3965 |
| CLogS | -5.16 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 376.71 |
| Relative PSA | 0.3053 |
| PolarSurfaceArea | 127.35 |
| Druglikeness | 3.8355 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.63889 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]oxamide | 2 - N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]oxamide