| MolName | 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C16H12N5O3ClS |
| Smiles | [O-][N+](c(cc1)cc(/C=N\N(C(COc2ccccc2)=NN2)C2=S)c1Cl)=O |
| InChI | InChI=1S/C16H12ClN5O3S/c17-14-7-6-12(22(23)24)8-11(14)9-18-21-15(19-20-16(21)26)10-25-13-4-2-1-3-5-13/h1-9H,10H2,(H,20,26) |
| InChIK | YCNHWPFRELPOSP-UHFFFAOYSA-N |
| TotalMolweight | 389.822 |
| Molweight | 389.822 |
| MonoisotopicMass | 389.034937 |
| CLogP | 2.5796 |
| CLogS | -5.427 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 284.57 |
| Relative PSA | 0.37407 |
| PolarSurfaceArea | 127.13 |
| Druglikeness | -1.853 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(phenoxymethyl)-1H-1,2,4-triazole-5-thione