| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide |
| MolecularFormula | C34H32N4O |
| Smiles | O=C(c1ccc(CN2CCN(Cc3ccccc3)CC2)cc1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C34H32N4O/c39-34(36-35-23-33-31-12-6-4-10-29(31)22-30-11-5-7-13-32(30)33)28-16-14-27(15-17-28)25-38-20-18-37(19-21-38)24-26-8-2-1-3-9-26/h1-17,22-23H,18-21,24-25H2,(H,36,39) |
| InChIK | YDTCXEZHGNLLME-UHFFFAOYSA-N |
| TotalMolweight | 512.655 |
| Molweight | 512.655 |
| MonoisotopicMass | 512.257611 |
| CLogP | 6.7098 |
| CLogS | -7.339 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 405.61 |
| Relative PSA | 0.10628 |
| PolarSurfaceArea | 47.94 |
| Druglikeness | 9.2701 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58974 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 8 |
| Symmetricatoms | 12 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide