| MolName | N-[5-[2-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C27H21N6O2FS |
| Smiles | O=C(Cc1nnc(NC(c2ccccc2)=O)s1)N/N=C\c1cn(Cc(cccc2)c2F)c2c1cccc2 |
| InChI | InChI=1S/C27H21FN6O2S/c28-22-12-6-4-10-19(22)16-34-17-20(21-11-5-7-13-23(21)34)15-29-31-24(35)14-25-32-33-27(37-25)30-26(36)18-8-2-1-3-9-18/h1-13,15,17H,14,16H2,(H,31,35)(H,30,33,36) |
| InChIK | YDZHGVFLFKGAID-UHFFFAOYSA-N |
| TotalMolweight | 512.568 |
| Molweight | 512.568 |
| MonoisotopicMass | 512.143072 |
| CLogP | 4.8207 |
| CLogS | -5.697 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 386.85 |
| Relative PSA | 0.28352 |
| PolarSurfaceArea | 129.51 |
| Druglikeness | 6.6512 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59459 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2Z)-2-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide