| MolName | (Z)-1-(4-bromo-5-iodofuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C7H4N4OBrI |
| Smiles | Brc(cc(/C=N\n1cnnc1)o1)c1I |
| InChI | InChI=1S/C7H4BrIN4O/c8-6-1-5(14-7(6)9)2-12-13-3-10-11-4-13/h1-4H |
| InChIK | YEKBIAJOCAHAKZ-UHFFFAOYSA-N |
| TotalMolweight | 366.94 |
| Molweight | 366.94 |
| MonoisotopicMass | 365.86132 |
| CLogP | 1.6767 |
| CLogS | -5.605 |
| H Acceptors | 5 |
| TotalSurfaceArea | 179.1 |
| Relative PSA | 0.30391 |
| PolarSurfaceArea | 56.21 |
| Druglikeness | -1.3915 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromo-5-iodofuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(4-bromo-5-iodofuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine