| MolName | [(2Z)-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl] 2-(5-amino-1,3,4-thiadiazol-2-yl)acetate |
| MolecularFormula | C15H12N6O5S |
| Smiles | Nc1nnc(CC(ON/N=C\c2ccc(-c(cccc3)c3[N+]([O-])=O)o2)=O)s1 |
| InChI | InChI=1S/C15H12N6O5S/c16-15-19-18-13(27-15)7-14(22)26-20-17-8-9-5-6-12(25-9)10-3-1-2-4-11(10)21(23)24/h1-6,8,20H,7H2,(H2,16,19) |
| InChIK | YENWNQFNDPJKSJ-UHFFFAOYSA-N |
| TotalMolweight | 388.363 |
| Molweight | 388.363 |
| MonoisotopicMass | 388.058989 |
| CLogP | 2.0992 |
| CLogS | -4.939 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 285.85 |
| Relative PSA | 0.51814 |
| PolarSurfaceArea | 189.69 |
| Druglikeness | -4.2743 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(2Z)-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl] 2-(5-amino-1,3,4-thiadiazol-2-yl)acetate | 2 - [(2Z)-2-[[5-(2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl] 2-(5-amino-1,3,4-thiadiazol-2-yl)acetate