| MolName | 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-thiophen-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C24H24N6OS |
| Smiles | Nc1c(C(NCCC2=CCCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1cccs1 |
| InChI | InChI=1S/C24H24N6OS/c25-22-20(24(31)26-13-12-16-7-2-1-3-8-16)21-23(29-19-11-5-4-10-18(19)28-21)30(22)27-15-17-9-6-14-32-17/h4-7,9-11,14-15H,1-3,8,12-13,25H2,(H,26,31) |
| InChIK | YEWZGTQHGILUGF-UHFFFAOYSA-N |
| TotalMolweight | 444.562 |
| Molweight | 444.562 |
| MonoisotopicMass | 444.173229 |
| CLogP | 4.4206 |
| CLogS | -8.679 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 341.14 |
| Relative PSA | 0.29445 |
| PolarSurfaceArea | 126.43 |
| Druglikeness | 1.2364 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-thiophen-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-thiophen-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide