| MolName | 1-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea |
| MolecularFormula | C22H20N5OF3S2 |
| Smiles | FC(c1cccc(NC(N/N=C\c2c(-c3ccccc3)nc(N3CCOCC3)s2)=S)c1)(F)F |
| InChI | InChI=1S/C22H20F3N5OS2/c23-22(24,25)16-7-4-8-17(13-16)27-20(32)29-26-14-18-19(15-5-2-1-3-6-15)28-21(33-18)30-9-11-31-12-10-30/h1-8,13-14H,9-12H2,(H2,27,29,32) |
| InChIK | YFDADDSMSVQVQO-UHFFFAOYSA-N |
| TotalMolweight | 491.561 |
| Molweight | 491.561 |
| MonoisotopicMass | 491.106134 |
| CLogP | 5.5672 |
| CLogS | -6.823 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 359.17 |
| Relative PSA | 0.29877 |
| PolarSurfaceArea | 122.11 |
| Druglikeness | -2.4723 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea | 2 - 1-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-3-[3-(trifluoromethyl)phenyl]thiourea