| MolName | (Z)-1-(4-bromophenyl)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C21H15N4Br |
| Smiles | Brc1ccc(/C=N\n2c(-c3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15BrN4/c22-19-13-11-16(12-14-19)15-23-26-20(17-7-3-1-4-8-17)24-25-21(26)18-9-5-2-6-10-18/h1-15H |
| InChIK | YFQAKBOPVQUFDH-UHFFFAOYSA-N |
| TotalMolweight | 403.282 |
| Molweight | 403.282 |
| MonoisotopicMass | 402.048007 |
| CLogP | 5.2395 |
| CLogS | -9.434 |
| H Acceptors | 4 |
| TotalSurfaceArea | 282.65 |
| Relative PSA | 0.14265 |
| PolarSurfaceArea | 43.07 |
| Druglikeness | 1.7624 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromophenyl)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(4-bromophenyl)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)methanimine