| MolName | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1-phenylmethanamine |
| MolecularFormula | C14H12N2ClF |
| Smiles | Fc1cccc(Cl)c1/C=N\NCc1ccccc1 |
| InChI | InChI=1S/C14H12ClFN2/c15-13-7-4-8-14(16)12(13)10-18-17-9-11-5-2-1-3-6-11/h1-8,10,17H,9H2 |
| InChIK | YGBNIUPALZXNLE-UHFFFAOYSA-N |
| TotalMolweight | 262.714 |
| Molweight | 262.714 |
| MonoisotopicMass | 262.067303 |
| CLogP | 3.826 |
| CLogS | -4.642 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 204.77 |
| Relative PSA | 0.11217 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 1.6403 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1-phenylmethanamine | 2 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1-phenylmethanamine