| MolName | 3-chloro-N-[(Z)-[3-[2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| MolecularFormula | C25H22N6OCl2F6 |
| Smiles | FC(c(cc1Cl)cnc1N/N=C\c1cccc(OCCN(CC2)CCN2c(ncc(C(F)(F)F)c2)c2Cl)c1)(F)F |
| InChI | InChI=1S/C25H22Cl2F6N6O/c26-20-11-17(24(28,29)30)14-34-22(20)37-36-13-16-2-1-3-19(10-16)40-9-8-38-4-6-39(7-5-38)23-21(27)12-18(15-35-23)25(31,32)33/h1-3,10-15H,4-9H2,(H,34,37) |
| InChIK | YGRSRHGSLAXFAM-UHFFFAOYSA-N |
| TotalMolweight | 607.385 |
| Molweight | 607.385 |
| MonoisotopicMass | 606.113631 |
| CLogP | 7.6539 |
| CLogS | -6.492 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 415.94 |
| Relative PSA | 0.14908 |
| PolarSurfaceArea | 65.88 |
| Druglikeness | 0.25295 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-[3-[2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine | 2 - 3-chloro-N-[(Z)-[3-[2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine