| MolName | N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine |
| MolecularFormula | C14H14N4 |
| Smiles | C1NC(N/N=C\c2cc3ccccc3cc2)=NC1 |
| InChI | InChI=1S/C14H14N4/c1-2-4-13-9-11(5-6-12(13)3-1)10-17-18-14-15-7-8-16-14/h1-6,9-10H,7-8H2,(H2,15,16,18) |
| InChIK | YGUBABMYJVJMMM-UHFFFAOYSA-N |
| TotalMolweight | 238.293 |
| Molweight | 238.293 |
| MonoisotopicMass | 238.121846 |
| CLogP | 2.6082 |
| CLogS | -4.538 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 192.53 |
| Relative PSA | 0.23861 |
| PolarSurfaceArea | 48.78 |
| Druglikeness | 5.6825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine | 2 - N-[(Z)-naphthalen-2-ylmethylideneamino]-4,5-dihydro-1H-imidazol-2-amine