| MolName | N-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C18H12N3O5F |
| Smiles | [O-][N+](c(cc(cc1)F)c1-c1ccc(/C=N\NC(c(cccc2)c2O)=O)o1)=O |
| InChI | InChI=1S/C18H12FN3O5/c19-11-5-7-13(15(9-11)22(25)26)17-8-6-12(27-17)10-20-21-18(24)14-3-1-2-4-16(14)23/h1-10,23H,(H,21,24) |
| InChIK | YGUCOXZSJWKVMV-UHFFFAOYSA-N |
| TotalMolweight | 369.307 |
| Molweight | 369.307 |
| MonoisotopicMass | 369.0761 |
| CLogP | 2.974 |
| CLogS | -5.659 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 272.81 |
| Relative PSA | 0.34324 |
| PolarSurfaceArea | 120.65 |
| Druglikeness | 0.035308 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-[5-(4-fluoro-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxybenzamide