| MolName | (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine |
| MolecularFormula | C24H23N3OCl2 |
| Smiles | Clc1cc(Cl)c(/C=N\N=C/C(CC/C2=C/c3ccccc3)=C2N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O/c25-22-9-8-20(23(26)15-22)16-27-28-17-21-7-6-19(14-18-4-2-1-3-5-18)24(21)29-10-12-30-13-11-29/h1-5,8-9,14-17H,6-7,10-13H2 |
| InChIK | YGXDHBMIXAEQOA-UHFFFAOYSA-N |
| TotalMolweight | 440.373 |
| Molweight | 440.373 |
| MonoisotopicMass | 439.121816 |
| CLogP | 6.5771 |
| CLogS | -6.17 |
| H Acceptors | 4 |
| TotalSurfaceArea | 336.87 |
| Relative PSA | 0.10856 |
| PolarSurfaceArea | 37.19 |
| Druglikeness | 2.844 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine | 2 - (Z)-1-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]methanimine