| MolName | [4-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C23H18N3O4Cl |
| Smiles | O=C(CNC(c(cc1)ccc1Cl)=O)N/N=C\c(cc1)ccc1OC(c1ccccc1)=O |
| InChI | InChI=1S/C23H18ClN3O4/c24-19-10-8-17(9-11-19)22(29)25-15-21(28)27-26-14-16-6-12-20(13-7-16)31-23(30)18-4-2-1-3-5-18/h1-14H,15H2,(H,25,29)(H,27,28) |
| InChIK | YHEUZPFTKDNKDB-UHFFFAOYSA-N |
| TotalMolweight | 435.866 |
| Molweight | 435.866 |
| MonoisotopicMass | 435.098584 |
| CLogP | 4.3218 |
| CLogS | -5.694 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 332.89 |
| Relative PSA | 0.25098 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.1016 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70968 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate