| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenoxyacetamide |
| MolecularFormula | C21H17N2O3Cl |
| Smiles | O=C(C(Oc1ccccc1)Oc1ccccc1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C21H17ClN2O3/c22-19-14-8-7-9-16(19)15-23-24-20(25)21(26-17-10-3-1-4-11-17)27-18-12-5-2-6-13-18/h1-15,21H,(H,24,25) |
| InChIK | YHHCGWQVQRPTER-UHFFFAOYSA-N |
| TotalMolweight | 380.83 |
| Molweight | 380.83 |
| MonoisotopicMass | 380.09277 |
| CLogP | 4.6202 |
| CLogS | -5.508 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 294.67 |
| Relative PSA | 0.19008 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.5419 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenoxyacetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,2-diphenoxyacetamide