| MolName | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
| MolecularFormula | C15H10N4O2ClF3S |
| Smiles | [O-][N+](c1c(/C=N\NC(Nc(cc(C(F)(F)F)cc2)c2Cl)=S)cccc1)=O |
| InChI | InChI=1S/C15H10ClF3N4O2S/c16-11-6-5-10(15(17,18)19)7-12(11)21-14(26)22-20-8-9-3-1-2-4-13(9)23(24)25/h1-8H,(H2,21,22,26) |
| InChIK | YHPZOUUNMLDJMK-UHFFFAOYSA-N |
| TotalMolweight | 402.783 |
| Molweight | 402.783 |
| MonoisotopicMass | 402.016507 |
| CLogP | 4.1249 |
| CLogS | -6.295 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 281.96 |
| Relative PSA | 0.3293 |
| PolarSurfaceArea | 114.33 |
| Druglikeness | -10.165 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea | 2 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea