| MolName | 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C17H17N2O2BrS |
| Smiles | O=C(COc(ccc1c2CCCC1)c2Br)N/N=C\c1cccs1 |
| InChI | InChI=1S/C17H17BrN2O2S/c18-17-14-6-2-1-4-12(14)7-8-15(17)22-11-16(21)20-19-10-13-5-3-9-23-13/h3,5,7-10H,1-2,4,6,11H2,(H,20,21) |
| InChIK | YHSPCAJKZGIMOF-UHFFFAOYSA-N |
| TotalMolweight | 393.304 |
| Molweight | 393.304 |
| MonoisotopicMass | 392.019409 |
| CLogP | 4.5251 |
| CLogS | -5.437 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 266.86 |
| Relative PSA | 0.24871 |
| PolarSurfaceArea | 78.93 |
| Druglikeness | -1.279 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-[(1-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide