| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C11H9N7O5 |
| Smiles | [O-][N+](c1nn(CC(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)cn1)=O |
| InChI | InChI=1S/C11H9N7O5/c19-10(6-16-7-12-11(15-16)18(22)23)14-13-5-8-1-3-9(4-2-8)17(20)21/h1-5,7H,6H2,(H,14,19) |
| InChIK | YIHQBVOIHRQCQU-UHFFFAOYSA-N |
| TotalMolweight | 319.236 |
| Molweight | 319.236 |
| MonoisotopicMass | 319.066518 |
| CLogP | -0.8389 |
| CLogS | -3.523 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 234.81 |
| Relative PSA | 0.53516 |
| PolarSurfaceArea | 163.81 |
| Druglikeness | 1.3516 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide