| MolName | N-cyclohexyl-2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C26H26N2O2Cl2S |
| Smiles | O=C(c1c(/N=C\c2ccc(-c(cc3)cc(Cl)c3Cl)o2)sc2c1CCCC2)NC1CCCCC1 |
| InChI | InChI=1S/C26H26Cl2N2O2S/c27-20-12-10-16(14-21(20)28)22-13-11-18(32-22)15-29-26-24(19-8-4-5-9-23(19)33-26)25(31)30-17-6-2-1-3-7-17/h10-15,17H,1-9H2,(H,30,31) |
| InChIK | YIJXKWKTDAUGJU-UHFFFAOYSA-N |
| TotalMolweight | 501.476 |
| Molweight | 501.476 |
| MonoisotopicMass | 500.109202 |
| CLogP | 7.3918 |
| CLogS | -8.921 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 372.56 |
| Relative PSA | 0.18918 |
| PolarSurfaceArea | 82.84 |
| Druglikeness | 1.7442 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 10 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-cyclohexyl-2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - N-cyclohexyl-2-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide