| MolName | [4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| MolecularFormula | C30H22N5O3ClS |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\c(cc1)ccc1OC(c1cccc(Cl)c1)=O |
| InChI | InChI=1S/C30H22ClN5O3S/c31-24-11-7-10-23(18-24)29(38)39-26-16-14-21(15-17-26)19-32-33-27(37)20-40-30-35-34-28(22-8-3-1-4-9-22)36(30)25-12-5-2-6-13-25/h1-19H,20H2,(H,33,37) |
| InChIK | YINYVEJZVJSWNK-UHFFFAOYSA-N |
| TotalMolweight | 568.056 |
| Molweight | 568.056 |
| MonoisotopicMass | 567.113187 |
| CLogP | 6.5683 |
| CLogS | -10.622 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 427.41 |
| Relative PSA | 0.24648 |
| PolarSurfaceArea | 123.77 |
| Druglikeness | 5.1865 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.575 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate | 2 - [4-[(Z)-[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate