| MolName | 2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzonitrile |
| MolecularFormula | C14H9N5O |
| Smiles | N#Cc(cccc1)c1-c1ccc(/C=N\n2cnnc2)o1 |
| InChI | InChI=1S/C14H9N5O/c15-7-11-3-1-2-4-13(11)14-6-5-12(20-14)8-18-19-9-16-17-10-19/h1-6,8-10H |
| InChIK | YIRPQYWPZCSFOJ-UHFFFAOYSA-N |
| TotalMolweight | 263.259 |
| Molweight | 263.259 |
| MonoisotopicMass | 263.08071 |
| CLogP | 2.0028 |
| CLogS | -6.543 |
| H Acceptors | 6 |
| TotalSurfaceArea | 215.66 |
| Relative PSA | 0.31526 |
| PolarSurfaceArea | 80 |
| Druglikeness | 1.777 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzonitrile | 2 - 2-[5-[(Z)-1,2,4-triazol-4-yliminomethyl]furan-2-yl]benzonitrile