| MolName | N-[(Z)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
| MolecularFormula | C21H17N4O2ClS2 |
| Smiles | O=C(CSCc(cc1)ccc1Cl)N/N=C\c(o1)ccc1Sc1nc(cccc2)c2[nH]1 |
| InChI | InChI=1S/C21H17ClN4O2S2/c22-15-7-5-14(6-8-15)12-29-13-19(27)26-23-11-16-9-10-20(28-16)30-21-24-17-3-1-2-4-18(17)25-21/h1-11H,12-13H2,(H,24,25)(H,26,27) |
| InChIK | YJBAESDKDQUBLQ-UHFFFAOYSA-N |
| TotalMolweight | 456.977 |
| Molweight | 456.977 |
| MonoisotopicMass | 456.048143 |
| CLogP | 4.9461 |
| CLogS | -6.454 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 337.29 |
| Relative PSA | 0.32631 |
| PolarSurfaceArea | 133.88 |
| Druglikeness | 6.9521 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide | 2 - N-[(Z)-[5-(1H-benzimidazol-2-ylsulfanyl)furan-2-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide