| MolName | 2-[2-[(Z)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate |
| MolecularFormula | C17H12N4O3FS |
| Smiles | [O-]C(COc1c(/C=N\N(C(c(cccc2)c2F)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C17H13FN4O3S/c18-13-7-3-2-6-12(13)16-20-21-17(26)22(16)19-9-11-5-1-4-8-14(11)25-10-15(23)24/h1-9H,10H2,(H,21,26)(H,23,24)/p-1 |
| InChIK | YKJHUYOIBGTUEO-UHFFFAOYSA-M |
| TotalMolweight | 371.371 |
| Molweight | 371.371 |
| MonoisotopicMass | 371.061414 |
| CLogP | 0.3798 |
| CLogS | -4.558 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 277.11 |
| Relative PSA | 0.37296 |
| PolarSurfaceArea | 121.44 |
| Druglikeness | 2.2223 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[3-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenoxy]acetate