| MolName | 5-bromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C28H18N3O3Br |
| Smiles | N#Cc1c(COc2c(/C=N\NC(c3cc(cc(cc4)Br)c4o3)=O)c3ccccc3cc2)cccc1 |
| InChI | InChI=1S/C28H18BrN3O3/c29-22-10-12-25-21(13-22)14-27(35-25)28(33)32-31-16-24-23-8-4-3-5-18(23)9-11-26(24)34-17-20-7-2-1-6-19(20)15-30/h1-14,16H,17H2,(H,32,33) |
| InChIK | YLDVBCXEWSGRMB-UHFFFAOYSA-N |
| TotalMolweight | 524.373 |
| Molweight | 524.373 |
| MonoisotopicMass | 523.053153 |
| CLogP | 6.8105 |
| CLogS | -9.458 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 369.74 |
| Relative PSA | 0.19928 |
| PolarSurfaceArea | 87.62 |
| Druglikeness | -1.5933 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - 5-bromo-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-1-benzofuran-2-carboxamide