| MolName | N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(3-fluorophenyl)oxamide |
| MolecularFormula | C15H10N3O2Cl2F |
| Smiles | O=C(C(N/N=C\c(ccc(Cl)c1)c1Cl)=O)Nc1cc(F)ccc1 |
| InChI | InChI=1S/C15H10Cl2FN3O2/c16-10-5-4-9(13(17)6-10)8-19-21-15(23)14(22)20-12-3-1-2-11(18)7-12/h1-8H,(H,20,22)(H,21,23) |
| InChIK | YLIQILKZHNRKHJ-UHFFFAOYSA-N |
| TotalMolweight | 354.167 |
| Molweight | 354.167 |
| MonoisotopicMass | 353.013409 |
| CLogP | 3.4567 |
| CLogS | -5.311 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 253.39 |
| Relative PSA | 0.2388 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 2.42 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(3-fluorophenyl)oxamide | 2 - N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(3-fluorophenyl)oxamide