| MolName | (Z)-1-(3-phenyl-1,4-benzodioxin-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C17H12N4O2 |
| Smiles | C(C1=C(c2ccccc2)Oc(cccc2)c2O1)=N\n1cnnc1 |
| InChI | InChI=1S/C17H12N4O2/c1-2-6-13(7-3-1)17-16(10-20-21-11-18-19-12-21)22-14-8-4-5-9-15(14)23-17/h1-12H |
| InChIK | YLVWLXFFYHFSAY-UHFFFAOYSA-N |
| TotalMolweight | 304.308 |
| Molweight | 304.308 |
| MonoisotopicMass | 304.096026 |
| CLogP | 2.508 |
| CLogS | -5.894 |
| H Acceptors | 6 |
| TotalSurfaceArea | 233.68 |
| Relative PSA | 0.25813 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | 3.3405 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47826 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(3-phenyl-1,4-benzodioxin-2-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(3-phenyl-1,4-benzodioxin-2-yl)-N-(1,2,4-triazol-4-yl)methanimine