| MolName | [2-[(Z)-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C30H21N5O8 |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\c(cccc2)c2OC(c(cc2)ccc2[N+]([O-])=O)=O)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C30H21N5O8/c36-28(21-6-2-1-3-7-21)32-26(18-20-10-14-24(15-11-20)34(39)40)29(37)33-31-19-23-8-4-5-9-27(23)43-30(38)22-12-16-25(17-13-22)35(41)42/h1-19H,(H,32,36)(H,33,37) |
| InChIK | YMYWFKNSYNFIID-UHFFFAOYSA-N |
| TotalMolweight | 579.524 |
| Molweight | 579.524 |
| MonoisotopicMass | 579.139015 |
| CLogP | 4.4056 |
| CLogS | -7.856 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 435.52 |
| Relative PSA | 0.33153 |
| PolarSurfaceArea | 188.5 |
| Druglikeness | 1.108 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51163 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [2-[(Z)-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate