| MolName | 2-nitro-N-[(Z)-pyridin-2-ylmethylideneamino]-4-pyrrolidin-1-ylsulfonylaniline |
| MolecularFormula | C16H17N5O4S |
| Smiles | [O-][N+](c(cc(cc1)S(N2CCCC2)(=O)=O)c1N/N=C\c1ncccc1)=O |
| InChI | InChI=1S/C16H17N5O4S/c22-21(23)16-11-14(26(24,25)20-9-3-4-10-20)6-7-15(16)19-18-12-13-5-1-2-8-17-13/h1-2,5-8,11-12,19H,3-4,9-10H2 |
| InChIK | YNAUSTWEEZNAKO-UHFFFAOYSA-N |
| TotalMolweight | 375.408 |
| Molweight | 375.408 |
| MonoisotopicMass | 375.100125 |
| CLogP | 2.8372 |
| CLogS | -2.663 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 272.09 |
| Relative PSA | 0.35463 |
| PolarSurfaceArea | 128.86 |
| Druglikeness | -3.8883 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(Z)-pyridin-2-ylmethylideneamino]-4-pyrrolidin-1-ylsulfonylaniline | 2 - 2-nitro-N-[(Z)-pyridin-2-ylmethylideneamino]-4-pyrrolidin-1-ylsulfonylaniline