| MolName | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dichlorophenoxy)acetamide |
| MolecularFormula | C22H17N2O3Cl3 |
| Smiles | O=C(COc1cccc(Cl)c1Cl)N/N=C\c(cc1)ccc1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O3/c23-17-8-4-16(5-9-17)13-29-18-10-6-15(7-11-18)12-26-27-21(28)14-30-20-3-1-2-19(24)22(20)25/h1-12H,13-14H2,(H,27,28) |
| InChIK | YNLGHHARJYPDPZ-UHFFFAOYSA-N |
| TotalMolweight | 463.747 |
| Molweight | 463.747 |
| MonoisotopicMass | 462.030474 |
| CLogP | 5.9426 |
| CLogS | -7.05 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 340.53 |
| Relative PSA | 0.16448 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.2278 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dichlorophenoxy)acetamide | 2 - N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,3-dichlorophenoxy)acetamide