| MolName | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide |
| MolecularFormula | C22H18N2O2Cl2S |
| Smiles | O=C(CSc(cc1)ccc1Cl)N/N=C\c(cc1)ccc1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O2S/c23-18-5-1-17(2-6-18)14-28-20-9-3-16(4-10-20)13-25-26-22(27)15-29-21-11-7-19(24)8-12-21/h1-13H,14-15H2,(H,26,27) |
| InChIK | YNWBMKYWEPSKNU-UHFFFAOYSA-N |
| TotalMolweight | 445.369 |
| Molweight | 445.369 |
| MonoisotopicMass | 444.046602 |
| CLogP | 5.9745 |
| CLogS | -7.076 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 332.6 |
| Relative PSA | 0.19092 |
| PolarSurfaceArea | 75.99 |
| Druglikeness | 4.4844 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75862 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide | 2 - N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide