| MolName | 2-hydroxy-N-[(Z)-[4-(5-nitropyridin-2-yl)oxyphenyl]methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C26H20N4O5 |
| Smiles | [O-][N+](c(cc1)cnc1Oc1ccc(/C=N\NC(C(c2ccccc2)(c2ccccc2)O)=O)cc1)=O |
| InChI | InChI=1S/C26H20N4O5/c31-25(26(32,20-7-3-1-4-8-20)21-9-5-2-6-10-21)29-28-17-19-11-14-23(15-12-19)35-24-16-13-22(18-27-24)30(33)34/h1-18,32H,(H,29,31) |
| InChIK | YOEDGRWWKHUAHO-UHFFFAOYSA-N |
| TotalMolweight | 468.468 |
| Molweight | 468.468 |
| MonoisotopicMass | 468.143371 |
| CLogP | 3.3064 |
| CLogS | -6.914 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 355.7 |
| Relative PSA | 0.28254 |
| PolarSurfaceArea | 129.63 |
| Druglikeness | 0.25523 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[4-(5-nitropyridin-2-yl)oxyphenyl]methylideneamino]-2,2-diphenylacetamide | 2 - 2-hydroxy-N-[(Z)-[4-(5-nitropyridin-2-yl)oxyphenyl]methylideneamino]-2,2-diphenylacetamide