| MolName | (1R,2R,6S,7S)-4-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| MolecularFormula | C23H16N2O3ClF3 |
| Smiles | O=C([C@H]([C@@H]1C2=O)[C@@H]3C=C[C@H]1C31CC1)N2/N=C\c1ccc(-c(cc(C(F)(F)F)cc2)c2Cl)o1 |
| InChI | InChI=1S/C23H16ClF3N2O3/c24-16-5-1-11(23(25,26)27)9-13(16)17-6-2-12(32-17)10-28-29-20(30)18-14-3-4-15(19(18)21(29)31)22(14)7-8-22/h1-6,9-10,14-15,18-19H,7-8H2/t14-,15-,18-,19+/m1/s1 |
| InChIK | YOOAFJXUWGCWJM-RGCFKVTRSA-N |
| TotalMolweight | 460.838 |
| Molweight | 460.838 |
| MonoisotopicMass | 460.080154 |
| CLogP | 4.4393 |
| CLogS | -6.665 |
| H Acceptors | 5 |
| TotalSurfaceArea | 298.58 |
| Relative PSA | 0.18504 |
| PolarSurfaceArea | 62.88 |
| Druglikeness | 0.18323 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 3 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (1R,2R,6S,7S)-4-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione | 2 - (1R,2R,6S,7S)-4-[(Z)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione