| MolName | 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]thiourea |
| MolecularFormula | C17H19N3S |
| Smiles | S=C(NC1C(C2)C=CC2C1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C17H19N3S/c21-17(19-16-12-14-8-9-15(16)11-14)20-18-10-4-7-13-5-2-1-3-6-13/h1-10,14-16H,11-12H2,(H2,19,20,21) |
| InChIK | YOONQWDZLCUVFZ-UHFFFAOYSA-N |
| TotalMolweight | 297.425 |
| Molweight | 297.425 |
| MonoisotopicMass | 297.129967 |
| CLogP | 3.0855 |
| CLogS | -4.588 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 244.67 |
| Relative PSA | 0.25516 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 3.1787 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]thiourea | 2 - 1-(2-bicyclo[2.2.1]hept-5-enyl)-3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]thiourea