| MolName | 8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione |
| MolecularFormula | C15H15N6O3Cl |
| Smiles | CN(c1c(C(N2)=O)n(CCO)c(N/N=C\c(cc3)ccc3Cl)n1)C2=O |
| InChI | InChI=1S/C15H15ClN6O3/c1-21-12-11(13(24)19-15(21)25)22(6-7-23)14(18-12)20-17-8-9-2-4-10(16)5-3-9/h2-5,8,23H,6-7H2,1H3,(H,18,20)(H,19,24,25) |
| InChIK | YOQYFPZYDBJACO-UHFFFAOYSA-N |
| TotalMolweight | 362.776 |
| Molweight | 362.776 |
| MonoisotopicMass | 362.089416 |
| CLogP | 3.0548 |
| CLogS | -3.544 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 262.51 |
| Relative PSA | 0.36189 |
| PolarSurfaceArea | 111.85 |
| Druglikeness | 5.9409 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione | 2 - 8-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione