| MolName | [2,4-dibromo-6-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C21H13N3O5Br2 |
| Smiles | [O-][N+](c(cc1)ccc1C(N/N=C\c1cc(Br)cc(Br)c1OC(c1ccccc1)=O)=O)=O |
| InChI | InChI=1S/C21H13Br2N3O5/c22-16-10-15(12-24-25-20(27)13-6-8-17(9-7-13)26(29)30)19(18(23)11-16)31-21(28)14-4-2-1-3-5-14/h1-12H,(H,25,27) |
| InChIK | YPGQYEBQUJSOKM-UHFFFAOYSA-N |
| TotalMolweight | 547.158 |
| Molweight | 547.158 |
| MonoisotopicMass | 544.922194 |
| CLogP | 5.1609 |
| CLogS | -7.319 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 335.43 |
| Relative PSA | 0.26673 |
| PolarSurfaceArea | 113.58 |
| Druglikeness | -2.8781 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzoate | 2 - [2,4-dibromo-6-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] benzoate