| MolName | N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide |
| MolecularFormula | C26H22N2O4 |
| Smiles | O=C(c1ccco1)N/N=C\c(cc1)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H22N2O4/c29-26(24-12-7-15-30-24)28-27-17-22-13-14-23(31-18-20-8-3-1-4-9-20)25(16-22)32-19-21-10-5-2-6-11-21/h1-17H,18-19H2,(H,28,29) |
| InChIK | YPQSXPUADVDZBN-UHFFFAOYSA-N |
| TotalMolweight | 426.471 |
| Molweight | 426.471 |
| MonoisotopicMass | 426.157958 |
| CLogP | 5.0865 |
| CLogS | -6.085 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 343.72 |
| Relative PSA | 0.204 |
| PolarSurfaceArea | 73.06 |
| Druglikeness | 4.2096 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide | 2 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide