| MolName | 4-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C13H9N4OIS |
| Smiles | S=C(NN=C1c2ccccc2)N1/N=C\c(o1)ccc1I |
| InChI | InChI=1S/C13H9IN4OS/c14-11-7-6-10(19-11)8-15-18-12(16-17-13(18)20)9-4-2-1-3-5-9/h1-8H,(H,17,20) |
| InChIK | YPRRIPMRNOQONQ-UHFFFAOYSA-N |
| TotalMolweight | 396.207 |
| Molweight | 396.207 |
| MonoisotopicMass | 395.954179 |
| CLogP | 3.0182 |
| CLogS | -4.912 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 237.69 |
| Relative PSA | 0.33716 |
| PolarSurfaceArea | 85.22 |
| Druglikeness | 6.4819 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(5-iodofuran-2-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione