| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-phenylacetamide |
| MolecularFormula | C24H21N3O |
| Smiles | O=C(Cc1ccccc1)N/N=C\c1cn(Cc2ccccc2)c2c1cccc2 |
| InChI | InChI=1S/C24H21N3O/c28-24(15-19-9-3-1-4-10-19)26-25-16-21-18-27(17-20-11-5-2-6-12-20)23-14-8-7-13-22(21)23/h1-14,16,18H,15,17H2,(H,26,28) |
| InChIK | YQBUHAFCUWGXGG-UHFFFAOYSA-N |
| TotalMolweight | 367.451 |
| Molweight | 367.451 |
| MonoisotopicMass | 367.168462 |
| CLogP | 4.7294 |
| CLogS | -4.664 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 298.07 |
| Relative PSA | 0.14386 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 6.0796 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-phenylacetamide