| MolName | N-[(Z)-[(2E)-2-[3-[(E)-N-anilino-C-[(Z)-(phenylhydrazinylidene)methyl]carbonimidoyl]phenyl]-2-(phenylhydrazinylidene)ethylidene]amino]aniline |
| MolecularFormula | C34H30N8 |
| Smiles | C(/C(/c1cccc(/C(/C=N\Nc2ccccc2)=N\Nc2ccccc2)c1)=N/Nc1ccccc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C34H30N8/c1-5-16-29(17-6-1)37-35-25-33(41-39-31-20-9-3-10-21-31)27-14-13-15-28(24-27)34(42-40-32-22-11-4-12-23-32)26-36-38-30-18-7-2-8-19-30/h1-26,37-40H |
| InChIK | YQCGQUJORDNVFI-UHFFFAOYSA-N |
| TotalMolweight | 550.668 |
| Molweight | 550.668 |
| MonoisotopicMass | 550.259342 |
| CLogP | 12.116 |
| CLogS | -7.236 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 453.6 |
| Relative PSA | 0.20256 |
| PolarSurfaceArea | 97.56 |
| Druglikeness | 2.557 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45238 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 12 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 24 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(2E)-2-[3-[(E)-N-anilino-C-[(Z)-(phenylhydrazinylidene)methyl]carbonimidoyl]phenyl]-2-(phenylhydrazinylidene)ethylidene]amino]aniline | 2 - N-[(Z)-[(2E)-2-[3-[(E)-N-anilino-C-[(Z)-(phenylhydrazinylidene)methyl]carbonimidoyl]phenyl]-2-(phenylhydrazinylidene)ethylidene]amino]aniline