| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C23H20N9O3FS2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cc(OCc(cccc3)c3F)ccc2)=O)c1CSC1=NCCS1 |
| InChI | InChI=1S/C23H20FN9O3S2/c24-17-7-2-1-5-15(17)12-35-16-6-3-4-14(10-16)11-27-29-22(34)19-18(13-38-23-26-8-9-37-23)33(32-28-19)21-20(25)30-36-31-21/h1-7,10-11H,8-9,12-13H2,(H2,25,30)(H,29,34) |
| InChIK | YQEJKFNNKMNZBC-UHFFFAOYSA-N |
| TotalMolweight | 553.602 |
| Molweight | 553.602 |
| MonoisotopicMass | 553.111454 |
| CLogP | 4.5341 |
| CLogS | -5.078 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 404.8 |
| Relative PSA | 0.42646 |
| PolarSurfaceArea | 209.3 |
| Druglikeness | 1.0954 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 7 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[(Z)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide