| MolName | (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine |
| MolecularFormula | C14H16N2O2F4 |
| Smiles | FC(Oc1cc(OC(F)F)c(/C=N\N2CCCCC2)cc1)F |
| InChI | InChI=1S/C14H16F4N2O2/c15-13(16)21-11-5-4-10(12(8-11)22-14(17)18)9-19-20-6-2-1-3-7-20/h4-5,8-9,13-14H,1-3,6-7H2 |
| InChIK | YQEYNIKVWYQALE-UHFFFAOYSA-N |
| TotalMolweight | 320.285 |
| Molweight | 320.285 |
| MonoisotopicMass | 320.11479 |
| CLogP | 2.9943 |
| CLogS | -3.964 |
| H Acceptors | 4 |
| TotalSurfaceArea | 234.02 |
| Relative PSA | 0.14982 |
| PolarSurfaceArea | 34.06 |
| Druglikeness | -0.91469 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine | 2 - (Z)-1-[2,4-bis(difluoromethoxy)phenyl]-N-piperidin-1-ylmethanimine