| MolName | 4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]benzoic acid |
| MolecularFormula | C18H15N3O3S |
| Smiles | OC(c1ccc(/C=N\N(C=Nc2c3c(CCCC4)c4s2)C3=O)cc1)=O |
| InChI | InChI=1S/C18H15N3O3S/c22-17-15-13-3-1-2-4-14(13)25-16(15)19-10-21(17)20-9-11-5-7-12(8-6-11)18(23)24/h5-10H,1-4H2,(H,23,24) |
| InChIK | YQGCPCAJGMKDEY-UHFFFAOYSA-N |
| TotalMolweight | 353.401 |
| Molweight | 353.401 |
| MonoisotopicMass | 353.083412 |
| CLogP | 3.1701 |
| CLogS | -5.064 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 258.67 |
| Relative PSA | 0.3329 |
| PolarSurfaceArea | 110.57 |
| Druglikeness | 1.161 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]benzoic acid | 2 - 4-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]benzoic acid