| MolName | (2Z)-N-(4-bromophenyl)-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine |
| MolecularFormula | C23H22NO2Br |
| Smiles | Brc(cc1)ccc1/N=C/C=C1\OC2(CCCCC2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C23H22BrNO2/c24-19-9-11-20(12-10-19)25-16-13-21-17-22(18-7-3-1-4-8-18)27-23(26-21)14-5-2-6-15-23/h1,3-4,7-13,16-17H,2,5-6,14-15H2 |
| InChIK | YQIZUHUXFAJTTM-UHFFFAOYSA-N |
| TotalMolweight | 424.337 |
| Molweight | 424.337 |
| MonoisotopicMass | 423.08339 |
| CLogP | 5.1379 |
| CLogS | -5.926 |
| H Acceptors | 3 |
| TotalSurfaceArea | 298.04 |
| Relative PSA | 0.10572 |
| PolarSurfaceArea | 30.82 |
| Druglikeness | -6.1761 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-N-(4-bromophenyl)-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine | 2 - (2Z)-N-(4-bromophenyl)-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine